C32H52O2 — CID 145388631
(5R,10S,13R,14R,17R)-17-[(3S)-6-(hydroxymethyl)-7-methyloct-1-en-3-yl]-4,4,10,13,14-pentamethyl-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 145388631) has the molecular formula C32H52O2 and a molecular weight of 468.77 g/mol. Its IUPAC name is (5R,10S,13R,14R,17R)-17-[(3S)-6-(hydroxymethyl)-7-methyloct-1-en-3-yl]-4,4,10,13,14-pentamethyl-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (5R,10S,13R,14R,17R)-17-[(3S)-6-(hydroxymethyl)-7-methyloct-1-en-3-yl]-4,4,10,13,14-pentamethyl-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 145388631 |
| Molecular Formula | C32H52O2 |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.40 |
| IUPAC Name | (5R,10S,13R,14R,17R)-17-[(3S)-6-(hydroxymethyl)-7-methyloct-1-en-3-yl]-4,4,10,13,14-pentamethyl-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=C[C@H](CCC(CO)C(C)C)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CCC(=O)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C32H52O2/c1-9-22(10-11-23(20-33)21(2)3)24-14-18-32(8)26-12-13-27-29(4,5)28(34)16-17-30(27,6)25(26)15-19-31(24,32)7/h9,21-24,27,33H,1,10-20H2,2-8H3/t22-,23?,24-,27+,30-,31-,32+/m1/s1 |
| InChIKey | SLUNIMXQGVYOLX-XRFABHFUSA-N |
| XLogP | 8.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|