C16H28N2O3 — CID 145388941
[4-[[2-(butan-2-ylamino)acetyl]amino]cyclohexyl] 2-methylprop-2-enoate (PubChem CID 145388941) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is [4-[[2-(butan-2-ylamino)acetyl]amino]cyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [4-[[2-(butan-2-ylamino)acetyl]amino]cyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145388941 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | [4-[[2-(butan-2-ylamino)acetyl]amino]cyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCC(NC(=O)CNC(C)CC)CC1 |
| InChI | InChI=1S/C16H28N2O3/c1-5-12(4)17-10-15(19)18-13-6-8-14(9-7-13)21-16(20)11(2)3/h12-14,17H,2,5-10H2,1,3-4H3,(H,18,19) |
| InChIKey | FMZRBKAVROOIRQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|