C34H31FO5S2 — CID 145389670
[4-[2-fluoro-4-[4-(3-sulfanylpropylsulfanyl)phenyl]phenyl]phenyl] 4-(3-prop-2-enoyloxypropoxy)benzoate (PubChem CID 145389670) has the molecular formula C34H31FO5S2 and a molecular weight of 602.75 g/mol. Its IUPAC name is [4-[2-fluoro-4-[4-(3-sulfanylpropylsulfanyl)phenyl]phenyl]phenyl] 4-(3-prop-2-enoyloxypropoxy)benzoate.
| Compound Name | [4-[2-fluoro-4-[4-(3-sulfanylpropylsulfanyl)phenyl]phenyl]phenyl] 4-(3-prop-2-enoyloxypropoxy)benzoate |
|---|---|
| PubChem CID | 145389670 |
| Molecular Formula | C34H31FO5S2 |
| Molecular Weight | 602.75 g/mol |
| Exact Mass | 602.16 |
| IUPAC Name | [4-[2-fluoro-4-[4-(3-sulfanylpropylsulfanyl)phenyl]phenyl]phenyl] 4-(3-prop-2-enoyloxypropoxy)benzoate |
| SMILES | C=CC(=O)OCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(-c4ccc(SCCCS)cc4)cc3F)cc2)cc1 |
| InChI | InChI=1S/C34H31FO5S2/c1-2-33(36)39-20-3-19-38-28-12-7-26(8-13-28)34(37)40-29-14-5-25(6-15-29)31-18-11-27(23-32(31)35)24-9-16-30(17-10-24)42-22-4-21-41/h2,5-18,23,41H,1,3-4,19-22H2 |
| InChIKey | JPRNWUGCLRKUEO-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.75 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|