C8H20N2 — CID 145389782
ethane;N,N,1-trimethylazetidin-3-amine (PubChem CID 145389782) has the molecular formula C8H20N2 and a molecular weight of 144.26 g/mol. Its IUPAC name is ethane;N,N,1-trimethylazetidin-3-amine.
| Compound Name | ethane;N,N,1-trimethylazetidin-3-amine |
|---|---|
| PubChem CID | 145389782 |
| Molecular Formula | C8H20N2 |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.16 |
| IUPAC Name | ethane;N,N,1-trimethylazetidin-3-amine |
| SMILES | CC.CN1CC(N(C)C)C1 |
| InChI | InChI=1S/C6H14N2.C2H6/c1-7(2)6-4-8(3)5-6;1-2/h6H,4-5H2,1-3H3;1-2H3 |
| InChIKey | DNQGJBJADBNWOH-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |