C26H36N6O — CID 145389881
(3E,5E)-5-[6-amino-2-(butylamino)-9-[(3-methylphenyl)methyl]purin-8-yl]hepta-1,3,5-trien-3-ol;ethane (PubChem CID 145389881) has the molecular formula C26H36N6O and a molecular weight of 448.62 g/mol. Its IUPAC name is (3E,5E)-5-[6-amino-2-(butylamino)-9-[(3-methylphenyl)methyl]purin-8-yl]hepta-1,3,5-trien-3-ol;ethane.
| Compound Name | (3E,5E)-5-[6-amino-2-(butylamino)-9-[(3-methylphenyl)methyl]purin-8-yl]hepta-1,3,5-trien-3-ol;ethane |
|---|---|
| PubChem CID | 145389881 |
| Molecular Formula | C26H36N6O |
| Molecular Weight | 448.62 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | (3E,5E)-5-[6-amino-2-(butylamino)-9-[(3-methylphenyl)methyl]purin-8-yl]hepta-1,3,5-trien-3-ol;ethane |
| SMILES | C=C/C(O)=C\C(=C/C)c1nc2c(N)nc(NCCCC)nc2n1Cc1cccc(C)c1.CC |
| InChI | InChI=1S/C24H30N6O.C2H6/c1-5-8-12-26-24-28-21(25)20-23(29-24)30(15-17-11-9-10-16(4)13-17)22(27-20)18(6-2)14-19(31)7-3;1-2/h6-7,9-11,13-14,31H,3,5,8,12,15H2,1-2,4H3,(H3,25,26,28,29);1-2H3/b18-6+,19-14+; |
| InChIKey | NVDIKSQVCSVVSA-FEDHXGOISA-N |
| XLogP | 6.03 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.62 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|