C24H24ClF3N4O6 — CID 145389939
(3R,6R)-6-[[6-chloro-5-[[5-[2-(difluoromethoxy)ethoxy]-7-fluoro-2,3-dihydro-1H-inden-1-yl]amino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 145389939) has the molecular formula C24H24ClF3N4O6 and a molecular weight of 556.93 g/mol. Its IUPAC name is (3R,6R)-6-[[6-chloro-5-[[5-[2-(difluoromethoxy)ethoxy]-7-fluoro-2,3-dihydro-1H-inden-1-yl]amino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,6R)-6-[[6-chloro-5-[[5-[2-(difluoromethoxy)ethoxy]-7-fluoro-2,3-dihydro-1H-inden-1-yl]amino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 145389939 |
| Molecular Formula | C24H24ClF3N4O6 |
| Molecular Weight | 556.93 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | (3R,6R)-6-[[6-chloro-5-[[5-[2-(difluoromethoxy)ethoxy]-7-fluoro-2,3-dihydro-1H-inden-1-yl]amino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@@H]1COC2C1OC[C@H]2Oc1nc2nc(NC3CCc4cc(OCCOC(F)F)cc(F)c43)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C24H24ClF3N4O6/c25-12-7-15-22(32-24(30-15)38-17-9-37-19-16(33)8-36-20(17)19)31-21(12)29-14-2-1-10-5-11(6-13(26)18(10)14)34-3-4-35-23(27)28/h5-7,14,16-17,19-20,23,33H,1-4,8-9H2,(H2,29,30,31,32)/t14?,16-,17-,19?,20?/m1/s1 |
| InChIKey | WTZNZFVRPJKTLS-FXHOKRPUSA-N |
| XLogP | 3.37 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.93 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|