About [(Z)-4,4-difluoro-3-imino-2-methylbut-1-enyl]-methylazanium
[(Z)-4,4-difluoro-3-imino-2-methylbut-1-enyl]-methylazanium (PubChem CID 145390071) has the molecular formula C6H11F2N2+
and a molecular weight of 149.16 g/mol. Its IUPAC name is [(Z)-4,4-difluoro-3-imino-2-methylbut-1-enyl]-methylazanium.
Molecular Properties
| Compound Name | [(Z)-4,4-difluoro-3-imino-2-methylbut-1-enyl]-methylazanium |
| PubChem CID | 145390071 |
| Molecular Formula | C6H11F2N2+ |
| Molecular Weight | 149.16 g/mol |
| Exact Mass | 149.09 |
| IUPAC Name | [(Z)-4,4-difluoro-3-imino-2-methylbut-1-enyl]-methylazanium |
| SMILES | [H]/N=C(C(/C)=C\[NH2+]C)\C(F)F |
| InChI | InChI=1S/C6H10F2N2/c1-4(3-10-2)5(9)6(7)8/h3,6,9-10H,1-2H3/p+1/b4-3-,9-5- |
| InChIKey | YFRVZCGHSCBLEM-YSXYLNKBSA-O |
| XLogP | 0.37 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.16 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-4,4-difluoro-3-imino-2-methylbut-1-enyl]-methylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-4,4-difluoro-3-imino-2-methylbut-1-enyl]-methylazanium?
The IUPAC name of [(Z)-4,4-difluoro-3-imino-2-methylbut-1-enyl]-methylazanium (CID 145390071) is [(Z)-4,4-difluoro-3-imino-2-methylbut-1-enyl]-methylazanium.
What is the SMILES notation for [(Z)-4,4-difluoro-3-imino-2-methylbut-1-enyl]-methylazanium?
The canonical SMILES for [(Z)-4,4-difluoro-3-imino-2-methylbut-1-enyl]-methylazanium is [H]/N=C(C(/C)=C\[NH2+]C)\C(F)F.
What is the InChIKey of [(Z)-4,4-difluoro-3-imino-2-methylbut-1-enyl]-methylazanium?
The InChIKey is YFRVZCGHSCBLEM-YSXYLNKBSA-O. The full InChI is InChI=1S/C6H10F2N2/c1-4(3-10-2)5(9)6(7)8/h3,6,9-10H,1-2H3/p+1/b4-3-,9-5-.
What are the key properties of [(Z)-4,4-difluoro-3-imino-2-methylbut-1-enyl]-methylazanium?
[(Z)-4,4-difluoro-3-imino-2-methylbut-1-enyl]-methylazanium has a molecular weight of 149.16 g/mol, XLogP of 0.37, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-4,4-difluoro-3-imino-2-methylbut-1-enyl]-methylazanium is sourced from PubChem (CID 145390071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).