C35H27N3 — CID 145390737
9-(4,6-diphenylpyrimidin-2-yl)-2-methyl-6-phenyl-1,2-dihydrocarbazole (PubChem CID 145390737) has the molecular formula C35H27N3 and a molecular weight of 489.62 g/mol. Its IUPAC name is 9-(4,6-diphenylpyrimidin-2-yl)-2-methyl-6-phenyl-1,2-dihydrocarbazole.
| Compound Name | 9-(4,6-diphenylpyrimidin-2-yl)-2-methyl-6-phenyl-1,2-dihydrocarbazole |
|---|---|
| PubChem CID | 145390737 |
| Molecular Formula | C35H27N3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 9-(4,6-diphenylpyrimidin-2-yl)-2-methyl-6-phenyl-1,2-dihydrocarbazole |
| SMILES | CC1C=Cc2c(n(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)c3ccc(-c4ccccc4)cc23)C1 |
| InChI | InChI=1S/C35H27N3/c1-24-17-19-29-30-22-28(25-11-5-2-6-12-25)18-20-33(30)38(34(29)21-24)35-36-31(26-13-7-3-8-14-26)23-32(37-35)27-15-9-4-10-16-27/h2-20,22-24H,21H2,1H3 |
| InChIKey | KRIPXXPHHBACQY-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |