About 5-bromo-N-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)pyridin-2-amine;ethane
5-bromo-N-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)pyridin-2-amine;ethane (PubChem CID 145391575) has the molecular formula C10H11BrF6N2
and a molecular weight of 353.10 g/mol. Its IUPAC name is 5-bromo-N-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)pyridin-2-amine;ethane.
Molecular Properties
| Compound Name | 5-bromo-N-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)pyridin-2-amine;ethane |
| PubChem CID | 145391575 |
| Molecular Formula | C10H11BrF6N2 |
| Molecular Weight | 353.10 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 5-bromo-N-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)pyridin-2-amine;ethane |
| SMILES | CC.FC(F)(F)CNc1cc(C(F)(F)F)c(Br)cn1 |
| InChI | InChI=1S/C8H5BrF6N2.C2H6/c9-5-2-16-6(17-3-7(10,11)12)1-4(5)8(13,14)15;1-2/h1-2H,3H2,(H,16,17);1-2H3 |
| InChIKey | YRYLBVLWEHRWME-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.10 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-N-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)pyridin-2-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)pyridin-2-amine;ethane?
The IUPAC name of 5-bromo-N-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)pyridin-2-amine;ethane (CID 145391575) is 5-bromo-N-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)pyridin-2-amine;ethane.
What is the SMILES notation for 5-bromo-N-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)pyridin-2-amine;ethane?
The canonical SMILES for 5-bromo-N-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)pyridin-2-amine;ethane is CC.FC(F)(F)CNc1cc(C(F)(F)F)c(Br)cn1.
What is the InChIKey of 5-bromo-N-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)pyridin-2-amine;ethane?
The InChIKey is YRYLBVLWEHRWME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrF6N2.C2H6/c9-5-2-16-6(17-3-7(10,11)12)1-4(5)8(13,14)15;1-2/h1-2H,3H2,(H,16,17);1-2H3.
What are the key properties of 5-bromo-N-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)pyridin-2-amine;ethane?
5-bromo-N-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)pyridin-2-amine;ethane has a molecular weight of 353.10 g/mol, XLogP of 4.86, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)pyridin-2-amine;ethane is sourced from PubChem (CID 145391575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).