C12H14FN3O4 — CID 145393205
4-amino-1-[3-ethynyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-methylpyrimidin-2-one (PubChem CID 145393205) has the molecular formula C12H14FN3O4 and a molecular weight of 283.26 g/mol. Its IUPAC name is 4-amino-1-[3-ethynyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-methylpyrimidin-2-one.
| Compound Name | 4-amino-1-[3-ethynyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-methylpyrimidin-2-one |
|---|---|
| PubChem CID | 145393205 |
| Molecular Formula | C12H14FN3O4 |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 4-amino-1-[3-ethynyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-methylpyrimidin-2-one |
| SMILES | C#CC1(F)C(O)C(CO)OC1n1c(C)cc(N)nc1=O |
| InChI | InChI=1S/C12H14FN3O4/c1-3-12(13)9(18)7(5-17)20-10(12)16-6(2)4-8(14)15-11(16)19/h1,4,7,9-10,17-18H,5H2,2H3,(H2,14,15,19) |
| InChIKey | ZNDHENKQMWVLRQ-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|