C12H14F3N3O4 — CID 145393240
4-amino-1-[(4R)-1,4-difluoro-5,7-dihydroxy-6-methoxyhept-2-yn-4-yl]-5-fluoropyrimidin-2-one (PubChem CID 145393240) has the molecular formula C12H14F3N3O4 and a molecular weight of 321.26 g/mol. Its IUPAC name is 4-amino-1-[(4R)-1,4-difluoro-5,7-dihydroxy-6-methoxyhept-2-yn-4-yl]-5-fluoropyrimidin-2-one.
| Compound Name | 4-amino-1-[(4R)-1,4-difluoro-5,7-dihydroxy-6-methoxyhept-2-yn-4-yl]-5-fluoropyrimidin-2-one |
|---|---|
| PubChem CID | 145393240 |
| Molecular Formula | C12H14F3N3O4 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 4-amino-1-[(4R)-1,4-difluoro-5,7-dihydroxy-6-methoxyhept-2-yn-4-yl]-5-fluoropyrimidin-2-one |
| SMILES | COC(CO)C(O)[C@](F)(C#CCF)n1cc(F)c(N)nc1=O |
| InChI | InChI=1S/C12H14F3N3O4/c1-22-8(6-19)9(20)12(15,3-2-4-13)18-5-7(14)10(16)17-11(18)21/h5,8-9,19-20H,4,6H2,1H3,(H2,16,17,21)/t8?,9?,12-/m0/s1 |
| InChIKey | IGWJMZZZVUUGSI-KWPJZBAWSA-N |
| XLogP | -1.07 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|