C16H20N2 — CID 14539367
2-methyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine (PubChem CID 14539367) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-methyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine.
| Compound Name | 2-methyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine |
|---|---|
| PubChem CID | 14539367 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 2-methyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine |
| SMILES | CC1CCN2CCc3c([nH]c4ccccc34)C2C1 |
| InChI | InChI=1S/C16H20N2/c1-11-6-8-18-9-7-13-12-4-2-3-5-14(12)17-16(13)15(18)10-11/h2-5,11,15,17H,6-10H2,1H3 |
| InChIKey | RAGBGCLEOLTWAD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|