C19H27N3 — CID 145394533
2-[1-[(3Z)-2,5-dimethylidene-6-(methyliminomethyl)hepta-3,6-dienyl]-4-methylpiperidin-4-yl]acetonitrile (PubChem CID 145394533) has the molecular formula C19H27N3 and a molecular weight of 297.45 g/mol. Its IUPAC name is 2-[1-[(3Z)-2,5-dimethylidene-6-(methyliminomethyl)hepta-3,6-dienyl]-4-methylpiperidin-4-yl]acetonitrile.
| Compound Name | 2-[1-[(3Z)-2,5-dimethylidene-6-(methyliminomethyl)hepta-3,6-dienyl]-4-methylpiperidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 145394533 |
| Molecular Formula | C19H27N3 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 2-[1-[(3Z)-2,5-dimethylidene-6-(methyliminomethyl)hepta-3,6-dienyl]-4-methylpiperidin-4-yl]acetonitrile |
| SMILES | C=C(/C=C\C(=C)C(=C)/C=N/C)CN1CCC(C)(CC#N)CC1 |
| InChI | InChI=1S/C19H27N3/c1-16(6-7-17(2)18(3)14-21-5)15-22-12-9-19(4,8-11-20)10-13-22/h6-7,14H,1-3,8-10,12-13,15H2,4-5H3/b7-6-,21-14+ |
| InChIKey | DCAZCMOLQSASPI-YZANPOPOSA-N |
| XLogP | 3.93 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|