About ethane;2-[4-(3,3,3-trifluoropropylamino)cyclohexyl]acetonitrile
ethane;2-[4-(3,3,3-trifluoropropylamino)cyclohexyl]acetonitrile (PubChem CID 145395024) has the molecular formula C13H23F3N2
and a molecular weight of 264.33 g/mol. Its IUPAC name is ethane;2-[4-(3,3,3-trifluoropropylamino)cyclohexyl]acetonitrile.
Molecular Properties
| Compound Name | ethane;2-[4-(3,3,3-trifluoropropylamino)cyclohexyl]acetonitrile |
| PubChem CID | 145395024 |
| Molecular Formula | C13H23F3N2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | ethane;2-[4-(3,3,3-trifluoropropylamino)cyclohexyl]acetonitrile |
| SMILES | CC.N#CCC1CCC(NCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H17F3N2.C2H6/c12-11(13,14)6-8-16-10-3-1-9(2-4-10)5-7-15;1-2/h9-10,16H,1-6,8H2;1-2H3 |
| InChIKey | VDTKKEFMVGPXID-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-[4-(3,3,3-trifluoropropylamino)cyclohexyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-[4-(3,3,3-trifluoropropylamino)cyclohexyl]acetonitrile?
The IUPAC name of ethane;2-[4-(3,3,3-trifluoropropylamino)cyclohexyl]acetonitrile (CID 145395024) is ethane;2-[4-(3,3,3-trifluoropropylamino)cyclohexyl]acetonitrile.
What is the SMILES notation for ethane;2-[4-(3,3,3-trifluoropropylamino)cyclohexyl]acetonitrile?
The canonical SMILES for ethane;2-[4-(3,3,3-trifluoropropylamino)cyclohexyl]acetonitrile is CC.N#CCC1CCC(NCCC(F)(F)F)CC1.
What is the InChIKey of ethane;2-[4-(3,3,3-trifluoropropylamino)cyclohexyl]acetonitrile?
The InChIKey is VDTKKEFMVGPXID-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3N2.C2H6/c12-11(13,14)6-8-16-10-3-1-9(2-4-10)5-7-15;1-2/h9-10,16H,1-6,8H2;1-2H3.
What are the key properties of ethane;2-[4-(3,3,3-trifluoropropylamino)cyclohexyl]acetonitrile?
ethane;2-[4-(3,3,3-trifluoropropylamino)cyclohexyl]acetonitrile has a molecular weight of 264.33 g/mol, XLogP of 4.03, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-[4-(3,3,3-trifluoropropylamino)cyclohexyl]acetonitrile is sourced from PubChem (CID 145395024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).