About 2-[1-(3,3-difluorocyclobutanecarbonyl)-4-methylpiperidin-4-yl]acetonitrile;ethane
2-[1-(3,3-difluorocyclobutanecarbonyl)-4-methylpiperidin-4-yl]acetonitrile;ethane (PubChem CID 145395209) has the molecular formula C15H24F2N2O
and a molecular weight of 286.37 g/mol. Its IUPAC name is 2-[1-(3,3-difluorocyclobutanecarbonyl)-4-methylpiperidin-4-yl]acetonitrile;ethane.
Molecular Properties
| Compound Name | 2-[1-(3,3-difluorocyclobutanecarbonyl)-4-methylpiperidin-4-yl]acetonitrile;ethane |
| PubChem CID | 145395209 |
| Molecular Formula | C15H24F2N2O |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 2-[1-(3,3-difluorocyclobutanecarbonyl)-4-methylpiperidin-4-yl]acetonitrile;ethane |
| SMILES | CC.CC1(CC#N)CCN(C(=O)C2CC(F)(F)C2)CC1 |
| InChI | InChI=1S/C13H18F2N2O.C2H6/c1-12(2-5-16)3-6-17(7-4-12)11(18)10-8-13(14,15)9-10;1-2/h10H,2-4,6-9H2,1H3;1-2H3 |
| InChIKey | WMWUCKFNYVHNAB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[1-(3,3-difluorocyclobutanecarbonyl)-4-methylpiperidin-4-yl]acetonitrile;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(3,3-difluorocyclobutanecarbonyl)-4-methylpiperidin-4-yl]acetonitrile;ethane?
The IUPAC name of 2-[1-(3,3-difluorocyclobutanecarbonyl)-4-methylpiperidin-4-yl]acetonitrile;ethane (CID 145395209) is 2-[1-(3,3-difluorocyclobutanecarbonyl)-4-methylpiperidin-4-yl]acetonitrile;ethane.
What is the SMILES notation for 2-[1-(3,3-difluorocyclobutanecarbonyl)-4-methylpiperidin-4-yl]acetonitrile;ethane?
The canonical SMILES for 2-[1-(3,3-difluorocyclobutanecarbonyl)-4-methylpiperidin-4-yl]acetonitrile;ethane is CC.CC1(CC#N)CCN(C(=O)C2CC(F)(F)C2)CC1.
What is the InChIKey of 2-[1-(3,3-difluorocyclobutanecarbonyl)-4-methylpiperidin-4-yl]acetonitrile;ethane?
The InChIKey is WMWUCKFNYVHNAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F2N2O.C2H6/c1-12(2-5-16)3-6-17(7-4-12)11(18)10-8-13(14,15)9-10;1-2/h10H,2-4,6-9H2,1H3;1-2H3.
What are the key properties of 2-[1-(3,3-difluorocyclobutanecarbonyl)-4-methylpiperidin-4-yl]acetonitrile;ethane?
2-[1-(3,3-difluorocyclobutanecarbonyl)-4-methylpiperidin-4-yl]acetonitrile;ethane has a molecular weight of 286.37 g/mol, XLogP of 3.60, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(3,3-difluorocyclobutanecarbonyl)-4-methylpiperidin-4-yl]acetonitrile;ethane is sourced from PubChem (CID 145395209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).