C14H16ClF3N4O3 — CID 145395326
5-(4-chlorophenyl)-2-ethyl-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one;formamide (PubChem CID 145395326) has the molecular formula C14H16ClF3N4O3 and a molecular weight of 380.75 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-ethyl-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one;formamide.
| Compound Name | 5-(4-chlorophenyl)-2-ethyl-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one;formamide |
|---|---|
| PubChem CID | 145395326 |
| Molecular Formula | C14H16ClF3N4O3 |
| Molecular Weight | 380.75 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 5-(4-chlorophenyl)-2-ethyl-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one;formamide |
| SMILES | CCn1nc(-c2ccc(Cl)cc2)n(CC(O)C(F)(F)F)c1=O.NC=O |
| InChI | InChI=1S/C13H13ClF3N3O2.CH3NO/c1-2-20-12(22)19(7-10(21)13(15,16)17)11(18-20)8-3-5-9(14)6-4-8;2-1-3/h3-6,10,21H,2,7H2,1H3;1H,(H2,2,3) |
| InChIKey | FSDGRURQBRJSKN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 103.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.75 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|