About 4-[[(E)-4-amino-4-ethenylimino-3-methylbut-2-en-2-yl]-ethenylamino]butyl N-benzylcarbamate
4-[[(E)-4-amino-4-ethenylimino-3-methylbut-2-en-2-yl]-ethenylamino]butyl N-benzylcarbamate (PubChem CID 145395704) has the molecular formula C21H30N4O2
and a molecular weight of 370.50 g/mol. Its IUPAC name is 4-[[(E)-4-amino-4-ethenylimino-3-methylbut-2-en-2-yl]-ethenylamino]butyl N-benzylcarbamate.
Molecular Properties
| Compound Name | 4-[[(E)-4-amino-4-ethenylimino-3-methylbut-2-en-2-yl]-ethenylamino]butyl N-benzylcarbamate |
| PubChem CID | 145395704 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 4-[[(E)-4-amino-4-ethenylimino-3-methylbut-2-en-2-yl]-ethenylamino]butyl N-benzylcarbamate |
| SMILES | C=C/N=C(N)/C(C)=C(\C)N(C=C)CCCCOC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C21H30N4O2/c1-5-23-20(22)17(3)18(4)25(6-2)14-10-11-15-27-21(26)24-16-19-12-8-7-9-13-19/h5-9,12-13H,1-2,10-11,14-16H2,3-4H3,(H2,22,23)(H,24,26)/b18-17+ |
| InChIKey | SNFFFIHNIHRUKD-ISLYRVAYSA-N |
| XLogP | 3.93 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(E)-4-amino-4-ethenylimino-3-methylbut-2-en-2-yl]-ethenylamino]butyl N-benzylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(E)-4-amino-4-ethenylimino-3-methylbut-2-en-2-yl]-ethenylamino]butyl N-benzylcarbamate?
The IUPAC name of 4-[[(E)-4-amino-4-ethenylimino-3-methylbut-2-en-2-yl]-ethenylamino]butyl N-benzylcarbamate (CID 145395704) is 4-[[(E)-4-amino-4-ethenylimino-3-methylbut-2-en-2-yl]-ethenylamino]butyl N-benzylcarbamate.
What is the SMILES notation for 4-[[(E)-4-amino-4-ethenylimino-3-methylbut-2-en-2-yl]-ethenylamino]butyl N-benzylcarbamate?
The canonical SMILES for 4-[[(E)-4-amino-4-ethenylimino-3-methylbut-2-en-2-yl]-ethenylamino]butyl N-benzylcarbamate is C=C/N=C(N)/C(C)=C(\C)N(C=C)CCCCOC(=O)NCc1ccccc1.
What is the InChIKey of 4-[[(E)-4-amino-4-ethenylimino-3-methylbut-2-en-2-yl]-ethenylamino]butyl N-benzylcarbamate?
The InChIKey is SNFFFIHNIHRUKD-ISLYRVAYSA-N. The full InChI is InChI=1S/C21H30N4O2/c1-5-23-20(22)17(3)18(4)25(6-2)14-10-11-15-27-21(26)24-16-19-12-8-7-9-13-19/h5-9,12-13H,1-2,10-11,14-16H2,3-4H3,(H2,22,23)(H,24,26)/b18-17+.
What are the key properties of 4-[[(E)-4-amino-4-ethenylimino-3-methylbut-2-en-2-yl]-ethenylamino]butyl N-benzylcarbamate?
4-[[(E)-4-amino-4-ethenylimino-3-methylbut-2-en-2-yl]-ethenylamino]butyl N-benzylcarbamate has a molecular weight of 370.50 g/mol, XLogP of 3.93, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(E)-4-amino-4-ethenylimino-3-methylbut-2-en-2-yl]-ethenylamino]butyl N-benzylcarbamate is sourced from PubChem (CID 145395704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).