C28H26F4N2O2 — CID 145395736
4-[3-(2-fluorophenyl)-1-methyl-5H-cyclopenta[c]pyridin-5-yl]butyl N-[[3-(trifluoromethyl)phenyl]methyl]carbamate (PubChem CID 145395736) has the molecular formula C28H26F4N2O2 and a molecular weight of 498.52 g/mol. Its IUPAC name is 4-[3-(2-fluorophenyl)-1-methyl-5H-cyclopenta[c]pyridin-5-yl]butyl N-[[3-(trifluoromethyl)phenyl]methyl]carbamate.
| Compound Name | 4-[3-(2-fluorophenyl)-1-methyl-5H-cyclopenta[c]pyridin-5-yl]butyl N-[[3-(trifluoromethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 145395736 |
| Molecular Formula | C28H26F4N2O2 |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 4-[3-(2-fluorophenyl)-1-methyl-5H-cyclopenta[c]pyridin-5-yl]butyl N-[[3-(trifluoromethyl)phenyl]methyl]carbamate |
| SMILES | Cc1nc(-c2ccccc2F)cc2c1C=CC2CCCCOC(=O)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H26F4N2O2/c1-18-22-13-12-20(24(22)16-26(34-18)23-10-2-3-11-25(23)29)8-4-5-14-36-27(35)33-17-19-7-6-9-21(15-19)28(30,31)32/h2-3,6-7,9-13,15-16,20H,4-5,8,14,17H2,1H3,(H,33,35) |
| InChIKey | JJVCEVRVAXTYJX-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|