C33H47N5O4S — CID 145396002
2,2-dimethylpropane;N-methyl-N-[3-[[3-(9-methyl-2,5-dioxo-7,8-dihydro-1H-pyrimido[4,5-e][1,4]diazepin-6-yl)phenyl]methoxy]-3-thiophen-2-ylpropyl]pentanamide (PubChem CID 145396002) has the molecular formula C33H47N5O4S and a molecular weight of 609.84 g/mol. Its IUPAC name is 2,2-dimethylpropane;N-methyl-N-[3-[[3-(9-methyl-2,5-dioxo-7,8-dihydro-1H-pyrimido[4,5-e][1,4]diazepin-6-yl)phenyl]methoxy]-3-thiophen-2-ylpropyl]pentanamide.
| Compound Name | 2,2-dimethylpropane;N-methyl-N-[3-[[3-(9-methyl-2,5-dioxo-7,8-dihydro-1H-pyrimido[4,5-e][1,4]diazepin-6-yl)phenyl]methoxy]-3-thiophen-2-ylpropyl]pentanamide |
|---|---|
| PubChem CID | 145396002 |
| Molecular Formula | C33H47N5O4S |
| Molecular Weight | 609.84 g/mol |
| Exact Mass | 609.33 |
| IUPAC Name | 2,2-dimethylpropane;N-methyl-N-[3-[[3-(9-methyl-2,5-dioxo-7,8-dihydro-1H-pyrimido[4,5-e][1,4]diazepin-6-yl)phenyl]methoxy]-3-thiophen-2-ylpropyl]pentanamide |
| SMILES | CC(C)(C)C.CCCCC(=O)N(C)CCC(OCc1cccc(N2CCN(C)c3[nH]c(=O)ncc3C2=O)c1)c1cccs1 |
| InChI | InChI=1S/C28H35N5O4S.C5H12/c1-4-5-11-25(34)31(2)13-12-23(24-10-7-16-38-24)37-19-20-8-6-9-21(17-20)33-15-14-32(3)26-22(27(33)35)18-29-28(36)30-26;1-5(2,3)4/h6-10,16-18,23H,4-5,11-15,19H2,1-3H3,(H,29,30,36);1-4H3 |
| InChIKey | HVFQPQNQRDUFRG-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.84 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |