About ethane;N-fluoro-N-phosphanylmethanamine;2-methyl-5-(1-propan-2-yloxypropyl)pyrazine
ethane;N-fluoro-N-phosphanylmethanamine;2-methyl-5-(1-propan-2-yloxypropyl)pyrazine (PubChem CID 145397126) has the molecular formula C14H29FN3OP
and a molecular weight of 305.38 g/mol. Its IUPAC name is ethane;N-fluoro-N-phosphanylmethanamine;2-methyl-5-(1-propan-2-yloxypropyl)pyrazine.
Molecular Properties
| Compound Name | ethane;N-fluoro-N-phosphanylmethanamine;2-methyl-5-(1-propan-2-yloxypropyl)pyrazine |
| PubChem CID | 145397126 |
| Molecular Formula | C14H29FN3OP |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | ethane;N-fluoro-N-phosphanylmethanamine;2-methyl-5-(1-propan-2-yloxypropyl)pyrazine |
| SMILES | CC.CCC(OC(C)C)c1cnc(C)cn1.CN(F)P |
| InChI | InChI=1S/C11H18N2O.C2H6.CH5FNP/c1-5-11(14-8(2)3)10-7-12-9(4)6-13-10;1-2;1-3(2)4/h6-8,11H,5H2,1-4H3;1-2H3;4H2,1H3 |
| InChIKey | BTWNHRFDDTVMDM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-fluoro-N-phosphanylmethanamine;2-methyl-5-(1-propan-2-yloxypropyl)pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-fluoro-N-phosphanylmethanamine;2-methyl-5-(1-propan-2-yloxypropyl)pyrazine?
The IUPAC name of ethane;N-fluoro-N-phosphanylmethanamine;2-methyl-5-(1-propan-2-yloxypropyl)pyrazine (CID 145397126) is ethane;N-fluoro-N-phosphanylmethanamine;2-methyl-5-(1-propan-2-yloxypropyl)pyrazine.
What is the SMILES notation for ethane;N-fluoro-N-phosphanylmethanamine;2-methyl-5-(1-propan-2-yloxypropyl)pyrazine?
The canonical SMILES for ethane;N-fluoro-N-phosphanylmethanamine;2-methyl-5-(1-propan-2-yloxypropyl)pyrazine is CC.CCC(OC(C)C)c1cnc(C)cn1.CN(F)P.
What is the InChIKey of ethane;N-fluoro-N-phosphanylmethanamine;2-methyl-5-(1-propan-2-yloxypropyl)pyrazine?
The InChIKey is BTWNHRFDDTVMDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O.C2H6.CH5FNP/c1-5-11(14-8(2)3)10-7-12-9(4)6-13-10;1-2;1-3(2)4/h6-8,11H,5H2,1-4H3;1-2H3;4H2,1H3.
What are the key properties of ethane;N-fluoro-N-phosphanylmethanamine;2-methyl-5-(1-propan-2-yloxypropyl)pyrazine?
ethane;N-fluoro-N-phosphanylmethanamine;2-methyl-5-(1-propan-2-yloxypropyl)pyrazine has a molecular weight of 305.38 g/mol, XLogP of 4.28, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-fluoro-N-phosphanylmethanamine;2-methyl-5-(1-propan-2-yloxypropyl)pyrazine is sourced from PubChem (CID 145397126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).