About S-bromo 2-(2-ethylphenyl)ethanethioate
S-bromo 2-(2-ethylphenyl)ethanethioate (PubChem CID 145397533) has the molecular formula C10H11BrOS
and a molecular weight of 259.17 g/mol. Its IUPAC name is S-bromo 2-(2-ethylphenyl)ethanethioate.
Molecular Properties
| Compound Name | S-bromo 2-(2-ethylphenyl)ethanethioate |
| PubChem CID | 145397533 |
| Molecular Formula | C10H11BrOS |
| Molecular Weight | 259.17 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | S-bromo 2-(2-ethylphenyl)ethanethioate |
| SMILES | CCc1ccccc1CC(=O)SBr |
| InChI | InChI=1S/C10H11BrOS/c1-2-8-5-3-4-6-9(8)7-10(12)13-11/h3-6H,2,7H2,1H3 |
| InChIKey | QYRYTGVQEWDLFE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.17 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-bromo 2-(2-ethylphenyl)ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-bromo 2-(2-ethylphenyl)ethanethioate?
The IUPAC name of S-bromo 2-(2-ethylphenyl)ethanethioate (CID 145397533) is S-bromo 2-(2-ethylphenyl)ethanethioate.
What is the SMILES notation for S-bromo 2-(2-ethylphenyl)ethanethioate?
The canonical SMILES for S-bromo 2-(2-ethylphenyl)ethanethioate is CCc1ccccc1CC(=O)SBr.
What is the InChIKey of S-bromo 2-(2-ethylphenyl)ethanethioate?
The InChIKey is QYRYTGVQEWDLFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrOS/c1-2-8-5-3-4-6-9(8)7-10(12)13-11/h3-6H,2,7H2,1H3.
What are the key properties of S-bromo 2-(2-ethylphenyl)ethanethioate?
S-bromo 2-(2-ethylphenyl)ethanethioate has a molecular weight of 259.17 g/mol, XLogP of 3.36, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-bromo 2-(2-ethylphenyl)ethanethioate is sourced from PubChem (CID 145397533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).