C11H18ClN3O2 — CID 145398456
3-(chloromethyl)-5-cyclohexyl-1,2,4-oxadiazole;N-methylformamide (PubChem CID 145398456) has the molecular formula C11H18ClN3O2 and a molecular weight of 259.74 g/mol. Its IUPAC name is 3-(chloromethyl)-5-cyclohexyl-1,2,4-oxadiazole;N-methylformamide.
| Compound Name | 3-(chloromethyl)-5-cyclohexyl-1,2,4-oxadiazole;N-methylformamide |
|---|---|
| PubChem CID | 145398456 |
| Molecular Formula | C11H18ClN3O2 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 3-(chloromethyl)-5-cyclohexyl-1,2,4-oxadiazole;N-methylformamide |
| SMILES | CNC=O.ClCc1noc(C2CCCCC2)n1 |
| InChI | InChI=1S/C9H13ClN2O.C2H5NO/c10-6-8-11-9(13-12-8)7-4-2-1-3-5-7;1-3-2-4/h7H,1-6H2;2H,1H3,(H,3,4) |
| InChIKey | HRNJAOVFRRDAMM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|