C26H43NO8S — CID 145399002
[(8S)-4-hydroxy-5,5,7,9,13-pentamethyl-2,6-dioxo-oxacyclohexadec-8-yl] 2-(2-formamido-3-oxopropyl)sulfanylacetate (PubChem CID 145399002) has the molecular formula C26H43NO8S and a molecular weight of 529.70 g/mol. Its IUPAC name is [(8S)-4-hydroxy-5,5,7,9,13-pentamethyl-2,6-dioxo-oxacyclohexadec-8-yl] 2-(2-formamido-3-oxopropyl)sulfanylacetate.
| Compound Name | [(8S)-4-hydroxy-5,5,7,9,13-pentamethyl-2,6-dioxo-oxacyclohexadec-8-yl] 2-(2-formamido-3-oxopropyl)sulfanylacetate |
|---|---|
| PubChem CID | 145399002 |
| Molecular Formula | C26H43NO8S |
| Molecular Weight | 529.70 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | [(8S)-4-hydroxy-5,5,7,9,13-pentamethyl-2,6-dioxo-oxacyclohexadec-8-yl] 2-(2-formamido-3-oxopropyl)sulfanylacetate |
| SMILES | CC1CCCOC(=O)CC(O)C(C)(C)C(=O)C(C)[C@@H](OC(=O)CSCC(C=O)NC=O)C(C)CCC1 |
| InChI | InChI=1S/C26H43NO8S/c1-17-8-6-10-18(2)24(35-23(32)15-36-14-20(13-28)27-16-29)19(3)25(33)26(4,5)21(30)12-22(31)34-11-7-9-17/h13,16-21,24,30H,6-12,14-15H2,1-5H3,(H,27,29)/t17?,18?,19?,20?,21?,24-/m0/s1 |
| InChIKey | CLCMKRWLXVGJIJ-GFCDBYRKSA-N |
| XLogP | 2.71 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.70 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|