C15H14O6 — CID 14539942
10a-methoxy-2-prop-1-en-2-yl-2,3-dihydropyrano[3,2-g][1,4]benzodioxine-7,10-dione (PubChem CID 14539942) has the molecular formula C15H14O6 and a molecular weight of 290.27 g/mol. Its IUPAC name is 10a-methoxy-2-prop-1-en-2-yl-2,3-dihydropyrano[3,2-g][1,4]benzodioxine-7,10-dione.
| Compound Name | 10a-methoxy-2-prop-1-en-2-yl-2,3-dihydropyrano[3,2-g][1,4]benzodioxine-7,10-dione |
|---|---|
| PubChem CID | 14539942 |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 10a-methoxy-2-prop-1-en-2-yl-2,3-dihydropyrano[3,2-g][1,4]benzodioxine-7,10-dione |
| SMILES | C=C(C)C1COC2=Cc3oc(=O)ccc3C(=O)C2(OC)O1 |
| InChI | InChI=1S/C15H14O6/c1-8(2)11-7-19-12-6-10-9(4-5-13(16)20-10)14(17)15(12,18-3)21-11/h4-6,11H,1,7H2,2-3H3 |
| InChIKey | AFWDOXKNPPBFPP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|