C34H43F4N3O7 — CID 145399538
tert-butyl 3-[[1-[2-(2-tert-butyl-N-methylanilino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate (PubChem CID 145399538) has the molecular formula C34H43F4N3O7 and a molecular weight of 681.72 g/mol. Its IUPAC name is tert-butyl 3-[[1-[2-(2-tert-butyl-N-methylanilino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate.
| Compound Name | tert-butyl 3-[[1-[2-(2-tert-butyl-N-methylanilino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
|---|---|
| PubChem CID | 145399538 |
| Molecular Formula | C34H43F4N3O7 |
| Molecular Weight | 681.72 g/mol |
| Exact Mass | 681.30 |
| IUPAC Name | tert-butyl 3-[[1-[2-(2-tert-butyl-N-methylanilino)-2-oxoacetyl]piperidine-4-carbonyl]amino]-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
| SMILES | CN(C(=O)C(=O)N1CCC(C(=O)NC(CC(=O)OC(C)(C)C)C(O)COc2c(F)c(F)cc(F)c2F)CC1)c1ccccc1C(C)(C)C |
| InChI | InChI=1S/C34H43F4N3O7/c1-33(2,3)20-10-8-9-11-24(20)40(7)31(45)32(46)41-14-12-19(13-15-41)30(44)39-23(17-26(43)48-34(4,5)6)25(42)18-47-29-27(37)21(35)16-22(36)28(29)38/h8-11,16,19,23,25,42H,12-15,17-18H2,1-7H3,(H,39,44) |
| InChIKey | GJGGTWZYDQXNPH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.72 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|