About ethane;2-fluoro-N-(3-hydroxypropyl)cyclopenta-1,4-diene-1-carboxamide;molecular hydrogen
ethane;2-fluoro-N-(3-hydroxypropyl)cyclopenta-1,4-diene-1-carboxamide;molecular hydrogen (PubChem CID 145399723) has the molecular formula C13H26FNO2
and a molecular weight of 247.35 g/mol. Its IUPAC name is ethane;2-fluoro-N-(3-hydroxypropyl)cyclopenta-1,4-diene-1-carboxamide;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;2-fluoro-N-(3-hydroxypropyl)cyclopenta-1,4-diene-1-carboxamide;molecular hydrogen |
| PubChem CID | 145399723 |
| Molecular Formula | C13H26FNO2 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | ethane;2-fluoro-N-(3-hydroxypropyl)cyclopenta-1,4-diene-1-carboxamide;molecular hydrogen |
| SMILES | CC.CC.O=C(NCCCO)C1=C(F)CC=C1.[H][H] |
| InChI | InChI=1S/C9H12FNO2.2C2H6.H2/c10-8-4-1-3-7(8)9(13)11-5-2-6-12;2*1-2;/h1,3,12H,2,4-6H2,(H,11,13);2*1-2H3;1H |
| InChIKey | GDRCSPSDZPKLJB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-fluoro-N-(3-hydroxypropyl)cyclopenta-1,4-diene-1-carboxamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-fluoro-N-(3-hydroxypropyl)cyclopenta-1,4-diene-1-carboxamide;molecular hydrogen?
The IUPAC name of ethane;2-fluoro-N-(3-hydroxypropyl)cyclopenta-1,4-diene-1-carboxamide;molecular hydrogen (CID 145399723) is ethane;2-fluoro-N-(3-hydroxypropyl)cyclopenta-1,4-diene-1-carboxamide;molecular hydrogen.
What is the SMILES notation for ethane;2-fluoro-N-(3-hydroxypropyl)cyclopenta-1,4-diene-1-carboxamide;molecular hydrogen?
The canonical SMILES for ethane;2-fluoro-N-(3-hydroxypropyl)cyclopenta-1,4-diene-1-carboxamide;molecular hydrogen is CC.CC.O=C(NCCCO)C1=C(F)CC=C1.[H][H].
What is the InChIKey of ethane;2-fluoro-N-(3-hydroxypropyl)cyclopenta-1,4-diene-1-carboxamide;molecular hydrogen?
The InChIKey is GDRCSPSDZPKLJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12FNO2.2C2H6.H2/c10-8-4-1-3-7(8)9(13)11-5-2-6-12;2*1-2;/h1,3,12H,2,4-6H2,(H,11,13);2*1-2H3;1H.
What are the key properties of ethane;2-fluoro-N-(3-hydroxypropyl)cyclopenta-1,4-diene-1-carboxamide;molecular hydrogen?
ethane;2-fluoro-N-(3-hydroxypropyl)cyclopenta-1,4-diene-1-carboxamide;molecular hydrogen has a molecular weight of 247.35 g/mol, XLogP of 2.97, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-fluoro-N-(3-hydroxypropyl)cyclopenta-1,4-diene-1-carboxamide;molecular hydrogen is sourced from PubChem (CID 145399723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).