C25H49NO — CID 145399817
(2S,4S)-2,4-dimethyloxane;(3R)-3,7,7-trimethyl-N-(3-methylbut-3-enyl)dec-1-en-2-amine (PubChem CID 145399817) has the molecular formula C25H49NO and a molecular weight of 379.67 g/mol. Its IUPAC name is (2S,4S)-2,4-dimethyloxane;(3R)-3,7,7-trimethyl-N-(3-methylbut-3-enyl)dec-1-en-2-amine.
| Compound Name | (2S,4S)-2,4-dimethyloxane;(3R)-3,7,7-trimethyl-N-(3-methylbut-3-enyl)dec-1-en-2-amine |
|---|---|
| PubChem CID | 145399817 |
| Molecular Formula | C25H49NO |
| Molecular Weight | 379.67 g/mol |
| Exact Mass | 379.38 |
| IUPAC Name | (2S,4S)-2,4-dimethyloxane;(3R)-3,7,7-trimethyl-N-(3-methylbut-3-enyl)dec-1-en-2-amine |
| SMILES | C=C(C)CCNC(=C)[C@H](C)CCCC(C)(C)CCC.C[C@H]1CCO[C@@H](C)C1 |
| InChI | InChI=1S/C18H35N.C7H14O/c1-8-12-18(6,7)13-9-10-16(4)17(5)19-14-11-15(2)3;1-6-3-4-8-7(2)5-6/h16,19H,2,5,8-14H2,1,3-4,6-7H3;6-7H,3-5H2,1-2H3/t16-;6-,7-/m10/s1 |
| InChIKey | KDZKIHYQWONQSY-UJUDJUTRSA-N |
| XLogP | 7.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.67 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|