C9H19NO — CID 145399843
(2S,3S,4R)-4-methoxy-2,3,4-trimethylpiperidine (PubChem CID 145399843) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is (2S,3S,4R)-4-methoxy-2,3,4-trimethylpiperidine.
| Compound Name | (2S,3S,4R)-4-methoxy-2,3,4-trimethylpiperidine |
|---|---|
| PubChem CID | 145399843 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | (2S,3S,4R)-4-methoxy-2,3,4-trimethylpiperidine |
| SMILES | CO[C@]1(C)CCN[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C9H19NO/c1-7-8(2)10-6-5-9(7,3)11-4/h7-8,10H,5-6H2,1-4H3/t7-,8-,9+/m0/s1 |
| InChIKey | LNIMFULWINILRY-XHNCKOQMSA-N |
| XLogP | 1.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |