C19H20F4N4O3 — CID 145399870
2-methylbut-3-en-2-yl (5S)-2-[[3-fluoro-2-(trifluoromethyl)-4-pyridinyl]methyl]-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylate (PubChem CID 145399870) has the molecular formula C19H20F4N4O3 and a molecular weight of 428.39 g/mol. Its IUPAC name is 2-methylbut-3-en-2-yl (5S)-2-[[3-fluoro-2-(trifluoromethyl)-4-pyridinyl]methyl]-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylate.
| Compound Name | 2-methylbut-3-en-2-yl (5S)-2-[[3-fluoro-2-(trifluoromethyl)-4-pyridinyl]methyl]-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 145399870 |
| Molecular Formula | C19H20F4N4O3 |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 2-methylbut-3-en-2-yl (5S)-2-[[3-fluoro-2-(trifluoromethyl)-4-pyridinyl]methyl]-3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-5-carboxylate |
| SMILES | C=CC(C)(C)OC(=O)[C@@H]1CCCc2nn(Cc3ccnc(C(F)(F)F)c3F)c(=O)n21 |
| InChI | InChI=1S/C19H20F4N4O3/c1-4-18(2,3)30-16(28)12-6-5-7-13-25-26(17(29)27(12)13)10-11-8-9-24-15(14(11)20)19(21,22)23/h4,8-9,12H,1,5-7,10H2,2-3H3/t12-/m0/s1 |
| InChIKey | LBEWKUVYVOCXFU-LBPRGKRZSA-N |
| XLogP | 3.03 |
| TPSA | 79.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|