C24H36F2O — CID 145400685
(3Z,7Z)-3,4-difluoro-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene;prop-1-ene (PubChem CID 145400685) has the molecular formula C24H36F2O and a molecular weight of 378.55 g/mol. Its IUPAC name is (3Z,7Z)-3,4-difluoro-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene;prop-1-ene.
| Compound Name | (3Z,7Z)-3,4-difluoro-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene;prop-1-ene |
|---|---|
| PubChem CID | 145400685 |
| Molecular Formula | C24H36F2O |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | (3Z,7Z)-3,4-difluoro-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7-triene;prop-1-ene |
| SMILES | C=C(/C=C\C(=C)C(C)CCC(C)CC)C(=C)/C(F)=C(\F)C(=C)OC.C=CC |
| InChI | InChI=1S/C21H30F2O.C3H6/c1-9-14(2)10-11-15(3)16(4)12-13-17(5)18(6)20(22)21(23)19(7)24-8;1-3-2/h12-15H,4-7,9-11H2,1-3,8H3;3H,1H2,2H3/b13-12-,21-20-; |
| InChIKey | PDAXTRBKTDIAAI-WBTXFMKCSA-N |
| XLogP | 8.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|