About 2,2-dimethylpentanal;4-N-methylbenzene-1,4-diamine
2,2-dimethylpentanal;4-N-methylbenzene-1,4-diamine (PubChem CID 145400763) has the molecular formula C14H24N2O
and a molecular weight of 236.36 g/mol. Its IUPAC name is 2,2-dimethylpentanal;4-N-methylbenzene-1,4-diamine.
Molecular Properties
| Compound Name | 2,2-dimethylpentanal;4-N-methylbenzene-1,4-diamine |
| PubChem CID | 145400763 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 2,2-dimethylpentanal;4-N-methylbenzene-1,4-diamine |
| SMILES | CCCC(C)(C)C=O.CNc1ccc(N)cc1 |
| InChI | InChI=1S/C7H10N2.C7H14O/c1-9-7-4-2-6(8)3-5-7;1-4-5-7(2,3)6-8/h2-5,9H,8H2,1H3;6H,4-5H2,1-3H3 |
| InChIKey | MBQNLKXHNFXVQU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylpentanal;4-N-methylbenzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpentanal;4-N-methylbenzene-1,4-diamine?
The IUPAC name of 2,2-dimethylpentanal;4-N-methylbenzene-1,4-diamine (CID 145400763) is 2,2-dimethylpentanal;4-N-methylbenzene-1,4-diamine.
What is the SMILES notation for 2,2-dimethylpentanal;4-N-methylbenzene-1,4-diamine?
The canonical SMILES for 2,2-dimethylpentanal;4-N-methylbenzene-1,4-diamine is CCCC(C)(C)C=O.CNc1ccc(N)cc1.
What is the InChIKey of 2,2-dimethylpentanal;4-N-methylbenzene-1,4-diamine?
The InChIKey is MBQNLKXHNFXVQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C7H14O/c1-9-7-4-2-6(8)3-5-7;1-4-5-7(2,3)6-8/h2-5,9H,8H2,1H3;6H,4-5H2,1-3H3.
What are the key properties of 2,2-dimethylpentanal;4-N-methylbenzene-1,4-diamine?
2,2-dimethylpentanal;4-N-methylbenzene-1,4-diamine has a molecular weight of 236.36 g/mol, XLogP of 3.32, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpentanal;4-N-methylbenzene-1,4-diamine is sourced from PubChem (CID 145400763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).