About ethane;4-(ethylamino)-1-methylcyclohepta-2,4,6-triene-1-carboxylic acid
ethane;4-(ethylamino)-1-methylcyclohepta-2,4,6-triene-1-carboxylic acid (PubChem CID 145400780) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is ethane;4-(ethylamino)-1-methylcyclohepta-2,4,6-triene-1-carboxylic acid.
Molecular Properties
| Compound Name | ethane;4-(ethylamino)-1-methylcyclohepta-2,4,6-triene-1-carboxylic acid |
| PubChem CID | 145400780 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | ethane;4-(ethylamino)-1-methylcyclohepta-2,4,6-triene-1-carboxylic acid |
| SMILES | CC.CCNC1=CC=CC(C)(C(=O)O)C=C1 |
| InChI | InChI=1S/C11H15NO2.C2H6/c1-3-12-9-5-4-7-11(2,8-6-9)10(13)14;1-2/h4-8,12H,3H2,1-2H3,(H,13,14);1-2H3 |
| InChIKey | JUXJKGACYFPOCE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-(ethylamino)-1-methylcyclohepta-2,4,6-triene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(ethylamino)-1-methylcyclohepta-2,4,6-triene-1-carboxylic acid?
The IUPAC name of ethane;4-(ethylamino)-1-methylcyclohepta-2,4,6-triene-1-carboxylic acid (CID 145400780) is ethane;4-(ethylamino)-1-methylcyclohepta-2,4,6-triene-1-carboxylic acid.
What is the SMILES notation for ethane;4-(ethylamino)-1-methylcyclohepta-2,4,6-triene-1-carboxylic acid?
The canonical SMILES for ethane;4-(ethylamino)-1-methylcyclohepta-2,4,6-triene-1-carboxylic acid is CC.CCNC1=CC=CC(C)(C(=O)O)C=C1.
What is the InChIKey of ethane;4-(ethylamino)-1-methylcyclohepta-2,4,6-triene-1-carboxylic acid?
The InChIKey is JUXJKGACYFPOCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2.C2H6/c1-3-12-9-5-4-7-11(2,8-6-9)10(13)14;1-2/h4-8,12H,3H2,1-2H3,(H,13,14);1-2H3.
What are the key properties of ethane;4-(ethylamino)-1-methylcyclohepta-2,4,6-triene-1-carboxylic acid?
ethane;4-(ethylamino)-1-methylcyclohepta-2,4,6-triene-1-carboxylic acid has a molecular weight of 223.32 g/mol, XLogP of 2.72, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(ethylamino)-1-methylcyclohepta-2,4,6-triene-1-carboxylic acid is sourced from PubChem (CID 145400780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).