C8H16N2 — CID 145401139
1-(1-ethylcyclopropyl)prop-2-ene-1,2-diamine (PubChem CID 145401139) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 1-(1-ethylcyclopropyl)prop-2-ene-1,2-diamine.
| Compound Name | 1-(1-ethylcyclopropyl)prop-2-ene-1,2-diamine |
|---|---|
| PubChem CID | 145401139 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 1-(1-ethylcyclopropyl)prop-2-ene-1,2-diamine |
| SMILES | C=C(N)C(N)C1(CC)CC1 |
| InChI | InChI=1S/C8H16N2/c1-3-8(4-5-8)7(10)6(2)9/h7H,2-5,9-10H2,1H3 |
| InChIKey | HVAOSUMQIKSXEV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |