C27H32N6OS3 — CID 145401439
3-[6-[[(5-amino-1,3-thiazol-2-yl)amino]methyl]-1-(1-propylsulfinylpiperidin-4-yl)indol-3-yl]benzenecarbothioamide (PubChem CID 145401439) has the molecular formula C27H32N6OS3 and a molecular weight of 552.80 g/mol. Its IUPAC name is 3-[6-[[(5-amino-1,3-thiazol-2-yl)amino]methyl]-1-(1-propylsulfinylpiperidin-4-yl)indol-3-yl]benzenecarbothioamide.
| Compound Name | 3-[6-[[(5-amino-1,3-thiazol-2-yl)amino]methyl]-1-(1-propylsulfinylpiperidin-4-yl)indol-3-yl]benzenecarbothioamide |
|---|---|
| PubChem CID | 145401439 |
| Molecular Formula | C27H32N6OS3 |
| Molecular Weight | 552.80 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | 3-[6-[[(5-amino-1,3-thiazol-2-yl)amino]methyl]-1-(1-propylsulfinylpiperidin-4-yl)indol-3-yl]benzenecarbothioamide |
| SMILES | CCCS(=O)N1CCC(n2cc(-c3cccc(C(N)=S)c3)c3ccc(CNc4ncc(N)s4)cc32)CC1 |
| InChI | InChI=1S/C27H32N6OS3/c1-2-12-37(34)32-10-8-21(9-11-32)33-17-23(19-4-3-5-20(14-19)26(29)35)22-7-6-18(13-24(22)33)15-30-27-31-16-25(28)36-27/h3-7,13-14,16-17,21H,2,8-12,15,28H2,1H3,(H2,29,35)(H,30,31) |
| InChIKey | FWLJFYANUBNOPU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.80 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|