C28H33N3O2 — CID 145402488
ethene;N-[1-[(3Z)-hexa-1,3,5-trien-2-yl]cyclopropyl]-7-(5H-imidazo[5,1-a]isoindol-5-yl)-6-oxoheptanamide (PubChem CID 145402488) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is ethene;N-[1-[(3Z)-hexa-1,3,5-trien-2-yl]cyclopropyl]-7-(5H-imidazo[5,1-a]isoindol-5-yl)-6-oxoheptanamide.
| Compound Name | ethene;N-[1-[(3Z)-hexa-1,3,5-trien-2-yl]cyclopropyl]-7-(5H-imidazo[5,1-a]isoindol-5-yl)-6-oxoheptanamide |
|---|---|
| PubChem CID | 145402488 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | ethene;N-[1-[(3Z)-hexa-1,3,5-trien-2-yl]cyclopropyl]-7-(5H-imidazo[5,1-a]isoindol-5-yl)-6-oxoheptanamide |
| SMILES | C=C.C=C/C=C\C(=C)C1(NC(=O)CCCCC(=O)CC2c3ccccc3-c3cncn32)CC1 |
| InChI | InChI=1S/C26H29N3O2.C2H4/c1-3-4-9-19(2)26(14-15-26)28-25(31)13-8-5-10-20(30)16-23-21-11-6-7-12-22(21)24-17-27-18-29(23)24;1-2/h3-4,6-7,9,11-12,17-18,23H,1-2,5,8,10,13-16H2,(H,28,31);1-2H2/b9-4-; |
| InChIKey | DXAPLWFDBZTUPP-WONROIIJSA-N |
| XLogP | 5.72 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|