C24H34F2N4 — CID 145402545
1-[2-(2,2-difluorocyclopropyl)ethyl]-4-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]piperidin-1-yl]-2H-pyridine;N-(methylideneamino)methanimine (PubChem CID 145402545) has the molecular formula C24H34F2N4 and a molecular weight of 416.56 g/mol. Its IUPAC name is 1-[2-(2,2-difluorocyclopropyl)ethyl]-4-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]piperidin-1-yl]-2H-pyridine;N-(methylideneamino)methanimine.
| Compound Name | 1-[2-(2,2-difluorocyclopropyl)ethyl]-4-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]piperidin-1-yl]-2H-pyridine;N-(methylideneamino)methanimine |
|---|---|
| PubChem CID | 145402545 |
| Molecular Formula | C24H34F2N4 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | 1-[2-(2,2-difluorocyclopropyl)ethyl]-4-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]piperidin-1-yl]-2H-pyridine;N-(methylideneamino)methanimine |
| SMILES | C=C/C(=C\C=C/C)C1CCN(C2=CCN(CCC3CC3(F)F)C=C2)CC1.C=NN=C |
| InChI | InChI=1S/C22H30F2N2.C2H4N2/c1-3-5-6-18(4-2)19-7-15-26(16-8-19)21-10-13-25(14-11-21)12-9-20-17-22(20,23)24;1-3-4-2/h3-6,10-11,13,19-20H,2,7-9,12,14-17H2,1H3;1-2H2/b5-3-,18-6+; |
| InChIKey | LFIVTZWMJBXSLK-BCYNCFPZSA-N |
| XLogP | 5.45 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|