C25H35FN4O2 — CID 145402944
[4-[4-[(3E,5Z)-4-fluoro-3-(methylideneamino)hepta-3,5-dienyl]piperazin-1-yl]-2,2-dimethyloxan-4-yl]-pyridin-2-ylmethanone (PubChem CID 145402944) has the molecular formula C25H35FN4O2 and a molecular weight of 442.58 g/mol. Its IUPAC name is [4-[4-[(3E,5Z)-4-fluoro-3-(methylideneamino)hepta-3,5-dienyl]piperazin-1-yl]-2,2-dimethyloxan-4-yl]-pyridin-2-ylmethanone.
| Compound Name | [4-[4-[(3E,5Z)-4-fluoro-3-(methylideneamino)hepta-3,5-dienyl]piperazin-1-yl]-2,2-dimethyloxan-4-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 145402944 |
| Molecular Formula | C25H35FN4O2 |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | [4-[4-[(3E,5Z)-4-fluoro-3-(methylideneamino)hepta-3,5-dienyl]piperazin-1-yl]-2,2-dimethyloxan-4-yl]-pyridin-2-ylmethanone |
| SMILES | C=N/C(CCN1CCN(C2(C(=O)c3ccccn3)CCOC(C)(C)C2)CC1)=C(F)\C=C/C |
| InChI | InChI=1S/C25H35FN4O2/c1-5-8-20(26)21(27-4)10-13-29-14-16-30(17-15-29)25(11-18-32-24(2,3)19-25)23(31)22-9-6-7-12-28-22/h5-9,12H,4,10-11,13-19H2,1-3H3/b8-5-,21-20+ |
| InChIKey | INNRJUDRAVCPEY-OFLYFWPXSA-N |
| XLogP | 4.06 |
| TPSA | 58.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|