C24H21F4N9O — CID 145404361
4-amino-5-cyclopropyl-5-pyridin-2-yl-2-[8-(3,3,4,4-tetrafluoropentyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 145404361) has the molecular formula C24H21F4N9O and a molecular weight of 527.49 g/mol. Its IUPAC name is 4-amino-5-cyclopropyl-5-pyridin-2-yl-2-[8-(3,3,4,4-tetrafluoropentyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5-cyclopropyl-5-pyridin-2-yl-2-[8-(3,3,4,4-tetrafluoropentyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 145404361 |
| Molecular Formula | C24H21F4N9O |
| Molecular Weight | 527.49 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | 4-amino-5-cyclopropyl-5-pyridin-2-yl-2-[8-(3,3,4,4-tetrafluoropentyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC(F)(F)C(F)(F)CCc1nc(-c2nc(N)c3c(n2)NC(=O)C3(c2ccccn2)C2CC2)cn2ncnc12 |
| InChI | InChI=1S/C24H21F4N9O/c1-22(25,26)23(27,28)8-7-13-20-31-11-32-37(20)10-14(33-13)18-34-17(29)16-19(35-18)36-21(38)24(16,12-5-6-12)15-4-2-3-9-30-15/h2-4,9-12H,5-8H2,1H3,(H3,29,34,35,36,38) |
| InChIKey | LKGSXNISZNBLKP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|