C29H37F3N8O3 — CID 145405146
1-[4-[7-[3-amino-2-methanimidoyl-6-(trifluoromethyl)phenyl]-2-(3-morpholin-4-ylpropoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 145405146) has the molecular formula C29H37F3N8O3 and a molecular weight of 602.66 g/mol. Its IUPAC name is 1-[4-[7-[3-amino-2-methanimidoyl-6-(trifluoromethyl)phenyl]-2-(3-morpholin-4-ylpropoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[7-[3-amino-2-methanimidoyl-6-(trifluoromethyl)phenyl]-2-(3-morpholin-4-ylpropoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 145405146 |
| Molecular Formula | C29H37F3N8O3 |
| Molecular Weight | 602.66 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | 1-[4-[7-[3-amino-2-methanimidoyl-6-(trifluoromethyl)phenyl]-2-(3-morpholin-4-ylpropoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | [H]/N=C/c1c(N)ccc(C(F)(F)F)c1N1CCc2c(nc(OCCCN3CCOCC3)nc2N2CCN(C(=O)C=C)CC2)C1 |
| InChI | InChI=1S/C29H37F3N8O3/c1-2-25(41)38-9-11-39(12-10-38)27-20-6-8-40(26-21(18-33)23(34)5-4-22(26)29(30,31)32)19-24(20)35-28(36-27)43-15-3-7-37-13-16-42-17-14-37/h2,4-5,18,33H,1,3,6-17,19,34H2/b33-18+ |
| InChIKey | LFUCYEGXUCQZON-DPNNOFEESA-N |
| XLogP | 2.57 |
| TPSA | 124.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.66 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|