C21H24F3NO3S — CID 145405331
[4-[5-ethyl-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-methyl-2,3-dihydropyrrol-4-yl]phenyl] trifluoromethanesulfonate (PubChem CID 145405331) has the molecular formula C21H24F3NO3S and a molecular weight of 427.49 g/mol. Its IUPAC name is [4-[5-ethyl-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-methyl-2,3-dihydropyrrol-4-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[5-ethyl-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-methyl-2,3-dihydropyrrol-4-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 145405331 |
| Molecular Formula | C21H24F3NO3S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | [4-[5-ethyl-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-methyl-2,3-dihydropyrrol-4-yl]phenyl] trifluoromethanesulfonate |
| SMILES | C=C/C=C(\C=C/C)C1(c2ccc(OS(=O)(=O)C(F)(F)F)cc2)CC(C)N=C1CC |
| InChI | InChI=1S/C21H24F3NO3S/c1-5-8-16(9-6-2)20(14-15(4)25-19(20)7-3)17-10-12-18(13-11-17)28-29(26,27)21(22,23)24/h5-6,8-13,15H,1,7,14H2,2-4H3/b9-6-,16-8+ |
| InChIKey | CWTYQSPECOYARZ-LSYVIMNDSA-N |
| XLogP | 5.48 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|