C24H24N10O2 — CID 145405817
N-[2-[[6-(2-aminoethylamino)-9-ethylpurin-2-yl]amino]-4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]formamide (PubChem CID 145405817) has the molecular formula C24H24N10O2 and a molecular weight of 484.52 g/mol. Its IUPAC name is N-[2-[[6-(2-aminoethylamino)-9-ethylpurin-2-yl]amino]-4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]formamide.
| Compound Name | N-[2-[[6-(2-aminoethylamino)-9-ethylpurin-2-yl]amino]-4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]formamide |
|---|---|
| PubChem CID | 145405817 |
| Molecular Formula | C24H24N10O2 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | N-[2-[[6-(2-aminoethylamino)-9-ethylpurin-2-yl]amino]-4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]formamide |
| SMILES | CCn1cnc2c(NCCN)nc(Nc3cc(-c4nnc(-c5ccccc5)o4)ccc3NC=O)nc21 |
| InChI | InChI=1S/C24H24N10O2/c1-2-34-13-27-19-20(26-11-10-25)30-24(31-21(19)34)29-18-12-16(8-9-17(18)28-14-35)23-33-32-22(36-23)15-6-4-3-5-7-15/h3-9,12-14H,2,10-11,25H2,1H3,(H,28,35)(H2,26,29,30,31) |
| InChIKey | MNZSFNIFXYYGRQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 161.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|