C23H21N9O2 — CID 145405824
N-[2-[(6-amino-9-propan-2-ylpurin-2-yl)amino]-4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]formamide (PubChem CID 145405824) has the molecular formula C23H21N9O2 and a molecular weight of 455.48 g/mol. Its IUPAC name is N-[2-[(6-amino-9-propan-2-ylpurin-2-yl)amino]-4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]formamide.
| Compound Name | N-[2-[(6-amino-9-propan-2-ylpurin-2-yl)amino]-4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]formamide |
|---|---|
| PubChem CID | 145405824 |
| Molecular Formula | C23H21N9O2 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | N-[2-[(6-amino-9-propan-2-ylpurin-2-yl)amino]-4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]formamide |
| SMILES | CC(C)n1cnc2c(N)nc(Nc3cc(-c4nnc(-c5ccccc5)o4)ccc3NC=O)nc21 |
| InChI | InChI=1S/C23H21N9O2/c1-13(2)32-11-25-18-19(24)28-23(29-20(18)32)27-17-10-15(8-9-16(17)26-12-33)22-31-30-21(34-22)14-6-4-3-5-7-14/h3-13H,1-2H3,(H,26,33)(H3,24,27,28,29) |
| InChIKey | OVECIGSWUQFUOH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 149.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|