C19H31F2N2O2P — CID 145406227
(2R)-2-(2,5-difluorophenyl)-5-morpholin-4-yl-N-phosphanyl-3,4-dihydro-2H-pyran-3-amine;ethane (PubChem CID 145406227) has the molecular formula C19H31F2N2O2P and a molecular weight of 388.44 g/mol. Its IUPAC name is (2R)-2-(2,5-difluorophenyl)-5-morpholin-4-yl-N-phosphanyl-3,4-dihydro-2H-pyran-3-amine;ethane.
| Compound Name | (2R)-2-(2,5-difluorophenyl)-5-morpholin-4-yl-N-phosphanyl-3,4-dihydro-2H-pyran-3-amine;ethane |
|---|---|
| PubChem CID | 145406227 |
| Molecular Formula | C19H31F2N2O2P |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | (2R)-2-(2,5-difluorophenyl)-5-morpholin-4-yl-N-phosphanyl-3,4-dihydro-2H-pyran-3-amine;ethane |
| SMILES | CC.CC.Fc1ccc(F)c([C@H]2OC=C(N3CCOCC3)CC2NP)c1 |
| InChI | InChI=1S/C15H19F2N2O2P.2C2H6/c16-10-1-2-13(17)12(7-10)15-14(18-22)8-11(9-21-15)19-3-5-20-6-4-19;2*1-2/h1-2,7,9,14-15,18H,3-6,8,22H2;2*1-2H3/t14?,15-;;/m1../s1 |
| InChIKey | NQYFXALHPMIEDI-GDUJOYNKSA-N |
| XLogP | 4.40 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|