C21H22ClF2NOS — CID 145406314
5-chloro-4-[[6-(ethylamino)-2-(3-fluorophenyl)cyclohex-2-en-1-yl]methoxy]-2-fluorobenzenethiol (PubChem CID 145406314) has the molecular formula C21H22ClF2NOS and a molecular weight of 409.93 g/mol. Its IUPAC name is 5-chloro-4-[[6-(ethylamino)-2-(3-fluorophenyl)cyclohex-2-en-1-yl]methoxy]-2-fluorobenzenethiol.
| Compound Name | 5-chloro-4-[[6-(ethylamino)-2-(3-fluorophenyl)cyclohex-2-en-1-yl]methoxy]-2-fluorobenzenethiol |
|---|---|
| PubChem CID | 145406314 |
| Molecular Formula | C21H22ClF2NOS |
| Molecular Weight | 409.93 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 5-chloro-4-[[6-(ethylamino)-2-(3-fluorophenyl)cyclohex-2-en-1-yl]methoxy]-2-fluorobenzenethiol |
| SMILES | CCNC1CCC=C(c2cccc(F)c2)C1COc1cc(F)c(S)cc1Cl |
| InChI | InChI=1S/C21H22ClF2NOS/c1-2-25-19-8-4-7-15(13-5-3-6-14(23)9-13)16(19)12-26-20-11-18(24)21(27)10-17(20)22/h3,5-7,9-11,16,19,25,27H,2,4,8,12H2,1H3 |
| InChIKey | HTEABIAFOPLOHQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.93 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|