C22H29N6O2S+ — CID 145407079
methyl-[2-[(10S,14R)-14-methyl-4-[2-(methylamino)benzimidazol-1-yl]-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-6-yl]propan-2-yl]sulfanium (PubChem CID 145407079) has the molecular formula C22H29N6O2S+ and a molecular weight of 441.58 g/mol. Its IUPAC name is methyl-[2-[(10S,14R)-14-methyl-4-[2-(methylamino)benzimidazol-1-yl]-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-6-yl]propan-2-yl]sulfanium.
| Compound Name | methyl-[2-[(10S,14R)-14-methyl-4-[2-(methylamino)benzimidazol-1-yl]-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-6-yl]propan-2-yl]sulfanium |
|---|---|
| PubChem CID | 145407079 |
| Molecular Formula | C22H29N6O2S+ |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | methyl-[2-[(10S,14R)-14-methyl-4-[2-(methylamino)benzimidazol-1-yl]-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-6-yl]propan-2-yl]sulfanium |
| SMILES | CNc1nc2ccccc2n1-c1nc2c(c(C(C)(C)[SH+]C)n1)OC[C@@H]1COC[C@@H](C)N21 |
| InChI | InChI=1S/C22H28N6O2S/c1-13-10-29-11-14-12-30-17-18(22(2,3)31-5)25-21(26-19(17)27(13)14)28-16-9-7-6-8-15(16)24-20(28)23-4/h6-9,13-14H,10-12H2,1-5H3,(H,23,24)/p+1/t13-,14+/m1/s1 |
| InChIKey | IEAOIPVVSHTLKZ-KGLIPLIRSA-O |
| XLogP | 2.52 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|