C17H29N3O2S — CID 145407114
(14S)-4,14-dimethyl-6-(2-methylsulfanylpropan-2-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene;ethane (PubChem CID 145407114) has the molecular formula C17H29N3O2S and a molecular weight of 339.51 g/mol. Its IUPAC name is (14S)-4,14-dimethyl-6-(2-methylsulfanylpropan-2-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene;ethane.
| Compound Name | (14S)-4,14-dimethyl-6-(2-methylsulfanylpropan-2-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene;ethane |
|---|---|
| PubChem CID | 145407114 |
| Molecular Formula | C17H29N3O2S |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | (14S)-4,14-dimethyl-6-(2-methylsulfanylpropan-2-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene;ethane |
| SMILES | CC.CSC(C)(C)c1nc(C)nc2c1OCC1COC[C@H](C)N21 |
| InChI | InChI=1S/C15H23N3O2S.C2H6/c1-9-6-19-7-11-8-20-12-13(15(3,4)21-5)16-10(2)17-14(12)18(9)11;1-2/h9,11H,6-8H2,1-5H3;1-2H3/t9-,11?;/m0./s1 |
| InChIKey | PQGLPAXUWWNSIK-QMOSYVFLSA-N |
| XLogP | 3.40 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |