About 6-(4-chlorophenyl)-2-(3-fluorophenyl)-3-oxopyridazine-4-carboxamide;cyclopentane
6-(4-chlorophenyl)-2-(3-fluorophenyl)-3-oxopyridazine-4-carboxamide;cyclopentane (PubChem CID 145407254) has the molecular formula C22H21ClFN3O2
and a molecular weight of 413.88 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2-(3-fluorophenyl)-3-oxopyridazine-4-carboxamide;cyclopentane.
Molecular Properties
| Compound Name | 6-(4-chlorophenyl)-2-(3-fluorophenyl)-3-oxopyridazine-4-carboxamide;cyclopentane |
| PubChem CID | 145407254 |
| Molecular Formula | C22H21ClFN3O2 |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 6-(4-chlorophenyl)-2-(3-fluorophenyl)-3-oxopyridazine-4-carboxamide;cyclopentane |
| SMILES | C1CCCC1.NC(=O)c1cc(-c2ccc(Cl)cc2)nn(-c2cccc(F)c2)c1=O |
| InChI | InChI=1S/C17H11ClFN3O2.C5H10/c18-11-6-4-10(5-7-11)15-9-14(16(20)23)17(24)22(21-15)13-3-1-2-12(19)8-13;1-2-4-5-3-1/h1-9H,(H2,20,23);1-5H2 |
| InChIKey | NIBRLXCSLVGUSF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(4-chlorophenyl)-2-(3-fluorophenyl)-3-oxopyridazine-4-carboxamide;cyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chlorophenyl)-2-(3-fluorophenyl)-3-oxopyridazine-4-carboxamide;cyclopentane?
The IUPAC name of 6-(4-chlorophenyl)-2-(3-fluorophenyl)-3-oxopyridazine-4-carboxamide;cyclopentane (CID 145407254) is 6-(4-chlorophenyl)-2-(3-fluorophenyl)-3-oxopyridazine-4-carboxamide;cyclopentane.
What is the SMILES notation for 6-(4-chlorophenyl)-2-(3-fluorophenyl)-3-oxopyridazine-4-carboxamide;cyclopentane?
The canonical SMILES for 6-(4-chlorophenyl)-2-(3-fluorophenyl)-3-oxopyridazine-4-carboxamide;cyclopentane is C1CCCC1.NC(=O)c1cc(-c2ccc(Cl)cc2)nn(-c2cccc(F)c2)c1=O.
What is the InChIKey of 6-(4-chlorophenyl)-2-(3-fluorophenyl)-3-oxopyridazine-4-carboxamide;cyclopentane?
The InChIKey is NIBRLXCSLVGUSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11ClFN3O2.C5H10/c18-11-6-4-10(5-7-11)15-9-14(16(20)23)17(24)22(21-15)13-3-1-2-12(19)8-13;1-2-4-5-3-1/h1-9H,(H2,20,23);1-5H2.
What are the key properties of 6-(4-chlorophenyl)-2-(3-fluorophenyl)-3-oxopyridazine-4-carboxamide;cyclopentane?
6-(4-chlorophenyl)-2-(3-fluorophenyl)-3-oxopyridazine-4-carboxamide;cyclopentane has a molecular weight of 413.88 g/mol, XLogP of 4.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chlorophenyl)-2-(3-fluorophenyl)-3-oxopyridazine-4-carboxamide;cyclopentane is sourced from PubChem (CID 145407254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).