C22H21ClFN3O2 — CID 145407254
6-(4-chlorophenyl)-2-(3-fluorophenyl)-3-oxopyridazine-4-carboxamide;cyclopentane (PubChem CID 145407254) has the molecular formula C22H21ClFN3O2 and a molecular weight of 413.88 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2-(3-fluorophenyl)-3-oxopyridazine-4-carboxamide;cyclopentane.
| Compound Name | 6-(4-chlorophenyl)-2-(3-fluorophenyl)-3-oxopyridazine-4-carboxamide;cyclopentane |
|---|---|
| PubChem CID | 145407254 |
| Molecular Formula | C22H21ClFN3O2 |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 6-(4-chlorophenyl)-2-(3-fluorophenyl)-3-oxopyridazine-4-carboxamide;cyclopentane |
| SMILES | C1CCCC1.NC(=O)c1cc(-c2ccc(Cl)cc2)nn(-c2cccc(F)c2)c1=O |
| InChI | InChI=1S/C17H11ClFN3O2.C5H10/c18-11-6-4-10(5-7-11)15-9-14(16(20)23)17(24)22(21-15)13-3-1-2-12(19)8-13;1-2-4-5-3-1/h1-9H,(H2,20,23);1-5H2 |
| InChIKey | NIBRLXCSLVGUSF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |