C10H19N3 — CID 145408254
ethane;N-methyl-4,5,6,7-tetrahydro-1H-indazol-3-amine (PubChem CID 145408254) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is ethane;N-methyl-4,5,6,7-tetrahydro-1H-indazol-3-amine.
| Compound Name | ethane;N-methyl-4,5,6,7-tetrahydro-1H-indazol-3-amine |
|---|---|
| PubChem CID | 145408254 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | ethane;N-methyl-4,5,6,7-tetrahydro-1H-indazol-3-amine |
| SMILES | CC.CNc1n[nH]c2c1CCCC2 |
| InChI | InChI=1S/C8H13N3.C2H6/c1-9-8-6-4-2-3-5-7(6)10-11-8;1-2/h2-5H2,1H3,(H2,9,10,11);1-2H3 |
| InChIKey | VNPNZSVWXHVITE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |