C15H16S2 — CID 145408406
(1Z,3E,5Z)-3-ethenyl-1-phenylhepta-1,3,5-triene-1,2-dithiol (PubChem CID 145408406) has the molecular formula C15H16S2 and a molecular weight of 260.43 g/mol. Its IUPAC name is (1Z,3E,5Z)-3-ethenyl-1-phenylhepta-1,3,5-triene-1,2-dithiol.
| Compound Name | (1Z,3E,5Z)-3-ethenyl-1-phenylhepta-1,3,5-triene-1,2-dithiol |
|---|---|
| PubChem CID | 145408406 |
| Molecular Formula | C15H16S2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | (1Z,3E,5Z)-3-ethenyl-1-phenylhepta-1,3,5-triene-1,2-dithiol |
| SMILES | C=CC(=C\C=C/C)/C(S)=C(/S)c1ccccc1 |
| InChI | InChI=1S/C15H16S2/c1-3-5-9-12(4-2)14(16)15(17)13-10-7-6-8-11-13/h3-11,16-17H,2H2,1H3/b5-3-,12-9+,15-14- |
| InChIKey | NCMLLMAZUZMVNK-PNFLGPGCSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|