C26H30F2N6O2 — CID 145408828
1-[6-[9-(difluoromethyl)-8-(1-methylpyrazol-4-yl)-2,3,3a,4,5,6-hexahydro-1H-pyrrolo[1,2-a][1]benzazepin-2-yl]-4-methoxy-2-pyridinyl]-3-methylurea (PubChem CID 145408828) has the molecular formula C26H30F2N6O2 and a molecular weight of 496.56 g/mol. Its IUPAC name is 1-[6-[9-(difluoromethyl)-8-(1-methylpyrazol-4-yl)-2,3,3a,4,5,6-hexahydro-1H-pyrrolo[1,2-a][1]benzazepin-2-yl]-4-methoxy-2-pyridinyl]-3-methylurea.
| Compound Name | 1-[6-[9-(difluoromethyl)-8-(1-methylpyrazol-4-yl)-2,3,3a,4,5,6-hexahydro-1H-pyrrolo[1,2-a][1]benzazepin-2-yl]-4-methoxy-2-pyridinyl]-3-methylurea |
|---|---|
| PubChem CID | 145408828 |
| Molecular Formula | C26H30F2N6O2 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | 1-[6-[9-(difluoromethyl)-8-(1-methylpyrazol-4-yl)-2,3,3a,4,5,6-hexahydro-1H-pyrrolo[1,2-a][1]benzazepin-2-yl]-4-methoxy-2-pyridinyl]-3-methylurea |
| SMILES | CNC(=O)Nc1cc(OC)cc(C2CC3CCCc4cc(-c5cnn(C)c5)c(C(F)F)cc4N3C2)n1 |
| InChI | InChI=1S/C26H30F2N6O2/c1-29-26(35)32-24-10-19(36-3)9-22(31-24)16-7-18-6-4-5-15-8-20(17-12-30-33(2)13-17)21(25(27)28)11-23(15)34(18)14-16/h8-13,16,18,25H,4-7,14H2,1-3H3,(H2,29,31,32,35) |
| InChIKey | MVRPBRUHTHEDBR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |